C18H18O4 — CID 21044101
3-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenyl]methyl]dioxetane (PubChem CID 21044101) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenyl]methyl]dioxetane.
| Compound Name | 3-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenyl]methyl]dioxetane |
|---|---|
| PubChem CID | 21044101 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[[4-[4-(oxiran-2-ylmethoxy)phenyl]phenyl]methyl]dioxetane |
| SMILES | c1cc(-c2ccc(OCC3CO3)cc2)ccc1CC1COO1 |
| InChI | InChI=1S/C18H18O4/c1-3-14(4-2-13(1)9-17-12-21-22-17)15-5-7-16(8-6-15)19-10-18-11-20-18/h1-8,17-18H,9-12H2 |
| InChIKey | RJYWPFGNAKSMCP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|