C15H21NO6 — CID 159331951
ethyl carbamate;2-(phenoxymethyl)oxirane;prop-2-enoic acid (PubChem CID 159331951) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is ethyl carbamate;2-(phenoxymethyl)oxirane;prop-2-enoic acid.
| Compound Name | ethyl carbamate;2-(phenoxymethyl)oxirane;prop-2-enoic acid |
|---|---|
| PubChem CID | 159331951 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | ethyl carbamate;2-(phenoxymethyl)oxirane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCOC(N)=O.c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C9H10O2.C3H7NO2.C3H4O2/c1-2-4-8(5-3-1)10-6-9-7-11-9;1-2-6-3(4)5;1-2-3(4)5/h1-5,9H,6-7H2;2H2,1H3,(H2,4,5);2H,1H2,(H,4,5) |
| InChIKey | LFBJLTPNSVJYEW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|