About azane;ethyl carbamate;prop-2-enoic acid
azane;ethyl carbamate;prop-2-enoic acid (PubChem CID 172762605) has the molecular formula C6H14N2O4
and a molecular weight of 178.19 g/mol. Its IUPAC name is azane;ethyl carbamate;prop-2-enoic acid.
Molecular Properties
| Compound Name | azane;ethyl carbamate;prop-2-enoic acid |
| PubChem CID | 172762605 |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | azane;ethyl carbamate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCOC(N)=O.N |
| InChI | InChI=1S/C3H7NO2.C3H4O2.H3N/c1-2-6-3(4)5;1-2-3(4)5;/h2H2,1H3,(H2,4,5);2H,1H2,(H,4,5);1H3 |
| InChIKey | LWTMUSZXWXLIPB-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;ethyl carbamate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl carbamate;prop-2-enoic acid?
The IUPAC name of azane;ethyl carbamate;prop-2-enoic acid (CID 172762605) is azane;ethyl carbamate;prop-2-enoic acid.
What is the SMILES notation for azane;ethyl carbamate;prop-2-enoic acid?
The canonical SMILES for azane;ethyl carbamate;prop-2-enoic acid is C=CC(=O)O.CCOC(N)=O.N.
What is the InChIKey of azane;ethyl carbamate;prop-2-enoic acid?
The InChIKey is LWTMUSZXWXLIPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C3H4O2.H3N/c1-2-6-3(4)5;1-2-3(4)5;/h2H2,1H3,(H2,4,5);2H,1H2,(H,4,5);1H3.
What are the key properties of azane;ethyl carbamate;prop-2-enoic acid?
azane;ethyl carbamate;prop-2-enoic acid has a molecular weight of 178.19 g/mol, XLogP of 0.52, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl carbamate;prop-2-enoic acid is sourced from PubChem (CID 172762605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).