About ethyl acetate;prop-2-enoic acid
ethyl acetate;prop-2-enoic acid (PubChem CID 87362107) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is ethyl acetate;prop-2-enoic acid.
Molecular Properties
| Compound Name | ethyl acetate;prop-2-enoic acid |
| PubChem CID | 87362107 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | ethyl acetate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCOC(C)=O |
| InChI | InChI=1S/C4H8O2.C3H4O2/c1-3-6-4(2)5;1-2-3(4)5/h3H2,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | OGBBGGRANWCZGA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;prop-2-enoic acid?
The IUPAC name of ethyl acetate;prop-2-enoic acid (CID 87362107) is ethyl acetate;prop-2-enoic acid.
What is the SMILES notation for ethyl acetate;prop-2-enoic acid?
The canonical SMILES for ethyl acetate;prop-2-enoic acid is C=CC(=O)O.CCOC(C)=O.
What is the InChIKey of ethyl acetate;prop-2-enoic acid?
The InChIKey is OGBBGGRANWCZGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C3H4O2/c1-3-6-4(2)5;1-2-3(4)5/h3H2,1-2H3;2H,1H2,(H,4,5).
What are the key properties of ethyl acetate;prop-2-enoic acid?
ethyl acetate;prop-2-enoic acid has a molecular weight of 160.17 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;prop-2-enoic acid is sourced from PubChem (CID 87362107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).