About ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate
ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate (PubChem CID 121452068) has the molecular formula C12H17NO9
and a molecular weight of 319.27 g/mol. Its IUPAC name is ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate.
Molecular Properties
| Compound Name | ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate |
| PubChem CID | 121452068 |
| Molecular Formula | C12H17NO9 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate |
| SMILES | C=CC(=O)O.C=CC(=O)OOOC(=O)C=C.CCOC(N)=O |
| InChI | InChI=1S/C6H6O5.C3H7NO2.C3H4O2/c1-3-5(7)9-11-10-6(8)4-2;1-2-6-3(4)5;1-2-3(4)5/h3-4H,1-2H2;2H2,1H3,(H2,4,5);2H,1H2,(H,4,5) |
| InChIKey | ICZZBQURUHKGGF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 151.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate?
The IUPAC name of ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate (CID 121452068) is ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate.
What is the SMILES notation for ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate?
The canonical SMILES for ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate is C=CC(=O)O.C=CC(=O)OOOC(=O)C=C.CCOC(N)=O.
What is the InChIKey of ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate?
The InChIKey is ICZZBQURUHKGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O5.C3H7NO2.C3H4O2/c1-3-5(7)9-11-10-6(8)4-2;1-2-6-3(4)5;1-2-3(4)5/h3-4H,1-2H2;2H2,1H3,(H2,4,5);2H,1H2,(H,4,5).
What are the key properties of ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate?
ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate has a molecular weight of 319.27 g/mol, XLogP of 0.65, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl carbamate;prop-2-enoic acid;prop-2-enoyloxy prop-2-eneperoxoate is sourced from PubChem (CID 121452068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).