C27H34O8 — CID 177277168
[2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate (PubChem CID 177277168) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 177277168 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | [2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-(oxiran-2-ylmethoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)COCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C27H34O8/c1-4-26(30)35-16-22(29)15-33-24-11-7-20(8-12-24)27(2,3)19-5-9-23(10-6-19)32-14-21(28)13-31-17-25-18-34-25/h4-12,21-22,25,28-29H,1,13-18H2,2-3H3 |
| InChIKey | ZKTQNFKYRMLUQH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|