C28H34O8 — CID 135300925
[3-[4-[2-[4-[3-(2-formylprop-2-enoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] prop-2-enoate (PubChem CID 135300925) has the molecular formula C28H34O8 and a molecular weight of 498.57 g/mol. Its IUPAC name is [3-[4-[2-[4-[3-(2-formylprop-2-enoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] prop-2-enoate.
| Compound Name | [3-[4-[2-[4-[3-(2-formylprop-2-enoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 135300925 |
| Molecular Formula | C28H34O8 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | [3-[4-[2-[4-[3-(2-formylprop-2-enoxy)-2-hydroxypropoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)COCC(=C)C=O)cc2)cc1 |
| InChI | InChI=1S/C28H34O8/c1-5-27(32)36-19-24(31)18-35-26-12-8-22(9-13-26)28(3,4)21-6-10-25(11-7-21)34-17-23(30)16-33-15-20(2)14-29/h5-14,23-24,30-31H,1-2,15-19H2,3-4H3 |
| InChIKey | FWFWSWDBUZPPBD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|