C30H43NO8 — CID 167345216
[2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[1-hydroxy-3-(propan-2-ylamino)propoxy]propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate (PubChem CID 167345216) has the molecular formula C30H43NO8 and a molecular weight of 545.67 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[1-hydroxy-3-(propan-2-ylamino)propoxy]propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate.
| Compound Name | [2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[1-hydroxy-3-(propan-2-ylamino)propoxy]propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 167345216 |
| Molecular Formula | C30H43NO8 |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | [2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[1-hydroxy-3-(propan-2-ylamino)propoxy]propoxy]phenyl]propan-2-yl]phenoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COc1ccc(C(C)(C)c2ccc(OCC(O)COC(O)CCNC(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H43NO8/c1-6-28(34)38-19-24(32)17-36-26-11-7-22(8-12-26)30(4,5)23-9-13-27(14-10-23)37-18-25(33)20-39-29(35)15-16-31-21(2)3/h6-14,21,24-25,29,31-33,35H,1,15-20H2,2-5H3 |
| InChIKey | ZNFPWZGKGHGNNM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|