C35H42Br2O10 — CID 165161414
[1-[4-[2-[4-[2-(2-bromo-2-methylpropanoyl)oxy-3-prop-2-enoyloxypropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-enoyloxypropan-2-yl] 2-bromo-2-methylpropanoate (PubChem CID 165161414) has the molecular formula C35H42Br2O10 and a molecular weight of 782.52 g/mol. Its IUPAC name is [1-[4-[2-[4-[2-(2-bromo-2-methylpropanoyl)oxy-3-prop-2-enoyloxypropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-enoyloxypropan-2-yl] 2-bromo-2-methylpropanoate.
| Compound Name | [1-[4-[2-[4-[2-(2-bromo-2-methylpropanoyl)oxy-3-prop-2-enoyloxypropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-enoyloxypropan-2-yl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 165161414 |
| Molecular Formula | C35H42Br2O10 |
| Molecular Weight | 782.52 g/mol |
| Exact Mass | 780.11 |
| IUPAC Name | [1-[4-[2-[4-[2-(2-bromo-2-methylpropanoyl)oxy-3-prop-2-enoyloxypropoxy]phenyl]propan-2-yl]phenoxy]-3-prop-2-enoyloxypropan-2-yl] 2-bromo-2-methylpropanoate |
| SMILES | C=CC(=O)OCC(COc1ccc(C(C)(C)c2ccc(OCC(COC(=O)C=C)OC(=O)C(C)(C)Br)cc2)cc1)OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C35H42Br2O10/c1-9-29(38)44-21-27(46-31(40)34(5,6)36)19-42-25-15-11-23(12-16-25)33(3,4)24-13-17-26(18-14-24)43-20-28(22-45-30(39)10-2)47-32(41)35(7,8)37/h9-18,27-28H,1-2,19-22H2,3-8H3 |
| InChIKey | LKKWLSFPFWQMQX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|