C33H40O9 — CID 59069632
[3-[4-[2-[4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 59069632) has the molecular formula C33H40O9 and a molecular weight of 580.67 g/mol. Its IUPAC name is [3-[4-[2-[4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-[2-[4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59069632 |
| Molecular Formula | C33H40O9 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | [3-[4-[2-[4-[2,3-bis(2-methylprop-2-enoyloxy)propoxy]phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1ccc(C(C)(C)c2ccc(OCC(COC(=O)C(=C)C)OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C33H40O9/c1-21(2)30(35)40-18-26(34)17-38-27-13-9-24(10-14-27)33(7,8)25-11-15-28(16-12-25)39-19-29(42-32(37)23(5)6)20-41-31(36)22(3)4/h9-16,26,29,34H,1,3,5,17-20H2,2,4,6-8H3 |
| InChIKey | QONAMQVPGGEUCA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|