C23H28O4 — CID 134322416
1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate (PubChem CID 134322416) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134322416 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COc1ccc(CC)cc1)COc1ccc(CC)cc1 |
| InChI | InChI=1S/C23H28O4/c1-5-18-7-11-20(12-8-18)25-15-22(27-23(24)17(3)4)16-26-21-13-9-19(6-2)10-14-21/h7-14,22H,3,5-6,15-16H2,1-2,4H3 |
| InChIKey | KKCFFQMFOCTZFZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|