1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate

C23H28O4 — CID 134322416

IUPAC1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC(COc1ccc(CC)cc1)COc1ccc(CC)cc1
InChIInChI=1S/C23H28O4/c1-5-18-7-11-20(12-8-18)25-15-22(27-23(24)17(3)4)16-26-21-13-9-19(6-2)10-14-21/h7-14,22H,3,5-6,15-16H2,1-2,4H3
InChIKeyKKCFFQMFOCTZFZ-UHFFFAOYSA-N
MW368.47 g/mol
LogP4.76
Rot. Bonds10

About 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate

1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate (PubChem CID 134322416) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate.

Molecular Properties

Compound Name1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate
PubChem CID134322416
Molecular FormulaC23H28O4
Molecular Weight368.47 g/mol
Exact Mass368.20
IUPAC Name1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate
SMILESC=C(C)C(=O)OC(COc1ccc(CC)cc1)COc1ccc(CC)cc1
InChIInChI=1S/C23H28O4/c1-5-18-7-11-20(12-8-18)25-15-22(27-23(24)17(3)4)16-26-21-13-9-19(6-2)10-14-21/h7-14,22H,3,5-6,15-16H2,1-2,4H3
InChIKeyKKCFFQMFOCTZFZ-UHFFFAOYSA-N
XLogP4.76
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.47
LogP ≤ 54.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate?
The IUPAC name of 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate (CID 134322416) is 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate.
What is the SMILES notation for 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate?
The canonical SMILES for 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate is C=C(C)C(=O)OC(COc1ccc(CC)cc1)COc1ccc(CC)cc1.
What is the InChIKey of 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate?
The InChIKey is KKCFFQMFOCTZFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28O4/c1-5-18-7-11-20(12-8-18)25-15-22(27-23(24)17(3)4)16-26-21-13-9-19(6-2)10-14-21/h7-14,22H,3,5-6,15-16H2,1-2,4H3.
What are the key properties of 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate?
1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate has a molecular weight of 368.47 g/mol, XLogP of 4.76, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(4-ethylphenoxy)propan-2-yl 2-methylprop-2-enoate is sourced from PubChem (CID 134322416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).