C33H32I2N4O4 — CID 163443530
[1-[4-[[4-(methylidene-λ3-iodanyl)phenyl]diazenyl]phenoxy]-3-[4-[2-[4-(methylidene-λ3-iodanyl)phenyl]hydrazinyl]phenoxy]propan-2-yl] 2-methylprop-2-enoate (PubChem CID 163443530) has the molecular formula C33H32I2N4O4 and a molecular weight of 802.45 g/mol. Its IUPAC name is [1-[4-[[4-(methylidene-λ3-iodanyl)phenyl]diazenyl]phenoxy]-3-[4-[2-[4-(methylidene-λ3-iodanyl)phenyl]hydrazinyl]phenoxy]propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[4-[[4-(methylidene-λ3-iodanyl)phenyl]diazenyl]phenoxy]-3-[4-[2-[4-(methylidene-λ3-iodanyl)phenyl]hydrazinyl]phenoxy]propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163443530 |
| Molecular Formula | C33H32I2N4O4 |
| Molecular Weight | 802.45 g/mol |
| Exact Mass | 802.05 |
| IUPAC Name | [1-[4-[[4-(methylidene-λ3-iodanyl)phenyl]diazenyl]phenoxy]-3-[4-[2-[4-(methylidene-λ3-iodanyl)phenyl]hydrazinyl]phenoxy]propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=Ic1ccc(/N=N/c2ccc(OCC(COc3ccc(NNc4ccc(I=C)cc4)cc3)OC(=O)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C33H32I2N4O4/c1-23(2)33(40)43-32(21-41-30-17-13-28(14-18-30)38-36-26-9-5-24(34-3)6-10-26)22-42-31-19-15-29(16-20-31)39-37-27-11-7-25(35-4)8-12-27/h5-20,32,36,38H,1,3-4,21-22H2,2H3/b39-37+ |
| InChIKey | BAOPPBVMRASNBX-NHFVQZBWSA-N |
| XLogP | 8.63 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.45 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|