C26H32O8 — CID 160914554
(1-hydroxy-3-phenoxypropan-2-yl) 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) 2-methylprop-2-enoate (PubChem CID 160914554) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is (1-hydroxy-3-phenoxypropan-2-yl) 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) 2-methylprop-2-enoate.
| Compound Name | (1-hydroxy-3-phenoxypropan-2-yl) 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160914554 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (1-hydroxy-3-phenoxypropan-2-yl) 2-methylprop-2-enoate;(2-hydroxy-3-phenoxypropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CO)COc1ccccc1.C=C(C)C(=O)OCC(O)COc1ccccc1 |
| InChI | InChI=1S/2C13H16O4/c1-10(2)13(15)17-9-11(14)8-16-12-6-4-3-5-7-12;1-10(2)13(15)17-12(8-14)9-16-11-6-4-3-5-7-11/h3-7,11,14H,1,8-9H2,2H3;3-7,12,14H,1,8-9H2,2H3 |
| InChIKey | SRFQMQDDMPGTJI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|