C14H15F3O5 — CID 177277226
[2-hydroxy-3-[3-(trifluoromethoxy)phenoxy]propyl] 2-methylprop-2-enoate (PubChem CID 177277226) has the molecular formula C14H15F3O5 and a molecular weight of 320.26 g/mol. Its IUPAC name is [2-hydroxy-3-[3-(trifluoromethoxy)phenoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[3-(trifluoromethoxy)phenoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177277226 |
| Molecular Formula | C14H15F3O5 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [2-hydroxy-3-[3-(trifluoromethoxy)phenoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3O5/c1-9(2)13(19)21-8-10(18)7-20-11-4-3-5-12(6-11)22-14(15,16)17/h3-6,10,18H,1,7-8H2,2H3 |
| InChIKey | MHPXULILXCHLHF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|