C15H15F3O6 — CID 177277344
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-(trifluoromethoxy)benzoate (PubChem CID 177277344) has the molecular formula C15H15F3O6 and a molecular weight of 348.27 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177277344 |
| Molecular Formula | C15H15F3O6 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-(trifluoromethoxy)benzoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3O6/c1-9(2)13(20)22-7-11(19)8-23-14(21)10-3-5-12(6-4-10)24-15(16,17)18/h3-6,11,19H,1,7-8H2,2H3 |
| InChIKey | SNDZTHVBDREMOY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|