C16H17F3O6 — CID 177277255
[2-hydroxy-3-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]propyl] 2-methylprop-2-enoate (PubChem CID 177277255) has the molecular formula C16H17F3O6 and a molecular weight of 362.30 g/mol. Its IUPAC name is [2-hydroxy-3-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 177277255 |
| Molecular Formula | C16H17F3O6 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [2-hydroxy-3-[2-oxo-2-[4-(trifluoromethoxy)phenyl]ethoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3O6/c1-10(2)15(22)24-8-12(20)7-23-9-14(21)11-3-5-13(6-4-11)25-16(17,18)19/h3-6,12,20H,1,7-9H2,2H3 |
| InChIKey | MXGOORZJSVBZJH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|