C24H28O12 — CID 59248463
1-O,3-O-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 5-O-methyl benzene-1,3,5-tricarboxylate (PubChem CID 59248463) has the molecular formula C24H28O12 and a molecular weight of 508.48 g/mol. Its IUPAC name is 1-O,3-O-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 5-O-methyl benzene-1,3,5-tricarboxylate.
| Compound Name | 1-O,3-O-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 5-O-methyl benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 59248463 |
| Molecular Formula | C24H28O12 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 1-O,3-O-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 5-O-methyl benzene-1,3,5-tricarboxylate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)c1cc(C(=O)OC)cc(C(=O)OCC(O)COC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C24H28O12/c1-13(2)20(27)33-9-18(25)11-35-23(30)16-6-15(22(29)32-5)7-17(8-16)24(31)36-12-19(26)10-34-21(28)14(3)4/h6-8,18-19,25-26H,1,3,9-12H2,2,4-5H3 |
| InChIKey | GDLNOXPXLALCNS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|