C12H18O7 — CID 89001607
4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 1-O-methyl butanedioate (PubChem CID 89001607) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is 4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 89001607 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-O-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 1-O-methyl butanedioate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CCC(=O)OC |
| InChI | InChI=1S/C12H18O7/c1-8(2)12(16)19-7-9(13)6-18-11(15)5-4-10(14)17-3/h9,13H,1,4-7H2,2-3H3 |
| InChIKey | YFCLMCRNEMXMHX-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|