C20H34O10 — CID 12800792
[2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]ethoxy]ethoxy]propyl] 2-methylprop-2-enoate (PubChem CID 12800792) has the molecular formula C20H34O10 and a molecular weight of 434.48 g/mol. Its IUPAC name is [2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]ethoxy]ethoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]ethoxy]ethoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 12800792 |
| Molecular Formula | C20H34O10 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | [2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]ethoxy]ethoxy]ethoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCCOCCOCCOCC(O)COC(=O)C(=C)C |
| InChI | InChI=1S/C20H34O10/c1-15(2)19(23)29-13-17(21)11-27-9-7-25-5-6-26-8-10-28-12-18(22)14-30-20(24)16(3)4/h17-18,21-22H,1,3,5-14H2,2,4H3 |
| InChIKey | YWBQMAUWGCZICT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|