C20H36O9 — CID 87523431
hexane-1,6-diol;[2-hydroxy-3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propyl] 2-methylprop-2-enoate (PubChem CID 87523431) has the molecular formula C20H36O9 and a molecular weight of 420.50 g/mol. Its IUPAC name is hexane-1,6-diol;[2-hydroxy-3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | hexane-1,6-diol;[2-hydroxy-3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87523431 |
| Molecular Formula | C20H36O9 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | hexane-1,6-diol;[2-hydroxy-3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCC(O)COC(=O)C(=C)C.OCCCCCCO |
| InChI | InChI=1S/C14H22O7.C6H14O2/c1-9(2)13(17)20-7-11(15)5-19-6-12(16)8-21-14(18)10(3)4;7-5-3-1-2-4-6-8/h11-12,15-16H,1,3,5-8H2,2,4H3;7-8H,1-6H2 |
| InChIKey | IRDYEZQZKGOMCH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|