C19H34O8 — CID 123927218
[2-hydroxy-3-[4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]butoxy]propyl] 2,2-dimethylpropanoate (PubChem CID 123927218) has the molecular formula C19H34O8 and a molecular weight of 390.47 g/mol. Its IUPAC name is [2-hydroxy-3-[4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]butoxy]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2-hydroxy-3-[4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]butoxy]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123927218 |
| Molecular Formula | C19H34O8 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | [2-hydroxy-3-[4-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]butoxy]propyl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCC(O)COCCCCOCC(O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H34O8/c1-14(2)17(22)26-12-15(20)10-24-8-6-7-9-25-11-16(21)13-27-18(23)19(3,4)5/h15-16,20-21H,1,6-13H2,2-5H3 |
| InChIKey | OREYQUPXHIOEKY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|