C12H21NO5 — CID 146532690
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2-amino-2-methylbutanoate (PubChem CID 146532690) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2-amino-2-methylbutanoate.
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2-amino-2-methylbutanoate |
|---|---|
| PubChem CID | 146532690 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2-amino-2-methylbutanoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C(C)(N)CC |
| InChI | InChI=1S/C12H21NO5/c1-5-12(4,13)11(16)18-7-9(14)6-17-10(15)8(2)3/h9,14H,2,5-7,13H2,1,3-4H3 |
| InChIKey | ZQKAHGPWVGREDM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|