C16H29O5P — CID 167150331
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2,4,4-trimethyl-2-methylphosphanylpentanoate (PubChem CID 167150331) has the molecular formula C16H29O5P and a molecular weight of 332.38 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2,4,4-trimethyl-2-methylphosphanylpentanoate.
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2,4,4-trimethyl-2-methylphosphanylpentanoate |
|---|---|
| PubChem CID | 167150331 |
| Molecular Formula | C16H29O5P |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 2,4,4-trimethyl-2-methylphosphanylpentanoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C(C)(CC(C)(C)C)PC |
| InChI | InChI=1S/C16H29O5P/c1-11(2)13(18)20-8-12(17)9-21-14(19)16(6,22-7)10-15(3,4)5/h12,17,22H,1,8-10H2,2-7H3 |
| InChIKey | BHCVTNFBSZUVSM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|