C18H32O4 — CID 89150629
(5-tert-butyl-2-hydroxy-7,7-dimethyl-4-oxooctyl) 2-methylprop-2-enoate (PubChem CID 89150629) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (5-tert-butyl-2-hydroxy-7,7-dimethyl-4-oxooctyl) 2-methylprop-2-enoate.
| Compound Name | (5-tert-butyl-2-hydroxy-7,7-dimethyl-4-oxooctyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89150629 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (5-tert-butyl-2-hydroxy-7,7-dimethyl-4-oxooctyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC(=O)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H32O4/c1-12(2)16(21)22-11-13(19)9-15(20)14(18(6,7)8)10-17(3,4)5/h13-14,19H,1,9-11H2,2-8H3 |
| InChIKey | KYHPLBZSOFQVKE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|