C10H16O5 — CID 20746567
(2-hydroxy-3-propanoyloxypropyl) 2-methylprop-2-enoate (PubChem CID 20746567) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (2-hydroxy-3-propanoyloxypropyl) 2-methylprop-2-enoate.
| Compound Name | (2-hydroxy-3-propanoyloxypropyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20746567 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (2-hydroxy-3-propanoyloxypropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CC |
| InChI | InChI=1S/C10H16O5/c1-4-9(12)14-5-8(11)6-15-10(13)7(2)3/h8,11H,2,4-6H2,1,3H3 |
| InChIKey | LUUIUSRHDNYICK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|