C13H26ClNO3 — CID 18541546
triethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]azanium chloride (PubChem CID 18541546) has the molecular formula C13H26ClNO3 and a molecular weight of 279.81 g/mol. Its IUPAC name is triethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]azanium chloride.
| Compound Name | triethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]azanium chloride |
|---|---|
| PubChem CID | 18541546 |
| Molecular Formula | C13H26ClNO3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | triethyl-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl]azanium chloride |
| SMILES | C=C(C)C(=O)OCC(O)C[N+](CC)(CC)CC.[Cl-] |
| InChI | InChI=1S/C13H26NO3.ClH/c1-6-14(7-2,8-3)9-12(15)10-17-13(16)11(4)5;/h12,15H,4,6-10H2,1-3,5H3;1H/q+1;/p-1 |
| InChIKey | WJWWMQDVQMMVKJ-UHFFFAOYSA-M |
| XLogP | -1.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|