C13H25ClNO3+ — CID 3022464
(3-chloro-2-hydroxypropyl)-diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 3022464) has the molecular formula C13H25ClNO3+ and a molecular weight of 278.80 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl)-diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | (3-chloro-2-hydroxypropyl)-diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 3022464 |
| Molecular Formula | C13H25ClNO3+ |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3-chloro-2-hydroxypropyl)-diethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](CC)(CC)CC(O)CCl |
| InChI | InChI=1S/C13H25ClNO3/c1-5-15(6-2,10-12(16)9-14)7-8-18-13(17)11(3)4/h12,16H,3,5-10H2,1-2,4H3/q+1 |
| InChIKey | FZGZEOYZRFFONW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|