C11H22BrNO3 — CID 140876303
[2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl]-trimethylazanium bromide (PubChem CID 140876303) has the molecular formula C11H22BrNO3 and a molecular weight of 296.21 g/mol. Its IUPAC name is [2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl]-trimethylazanium bromide.
| Compound Name | [2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl]-trimethylazanium bromide |
|---|---|
| PubChem CID | 140876303 |
| Molecular Formula | C11H22BrNO3 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | [2-hydroxy-4-(2-methylprop-2-enoyloxy)butyl]-trimethylazanium bromide |
| SMILES | C=C(C)C(=O)OCCC(O)C[N+](C)(C)C.[Br-] |
| InChI | InChI=1S/C11H22NO3.BrH/c1-9(2)11(14)15-7-6-10(13)8-12(3,4)5;/h10,13H,1,6-8H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | KOSLUJHPKKNGGF-UHFFFAOYSA-M |
| XLogP | -2.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|