C15H30BrNO3 — CID 140876270
[2-hydroxy-8-(2-methylprop-2-enoyloxy)octyl]-trimethylazanium bromide (PubChem CID 140876270) has the molecular formula C15H30BrNO3 and a molecular weight of 352.31 g/mol. Its IUPAC name is [2-hydroxy-8-(2-methylprop-2-enoyloxy)octyl]-trimethylazanium bromide.
| Compound Name | [2-hydroxy-8-(2-methylprop-2-enoyloxy)octyl]-trimethylazanium bromide |
|---|---|
| PubChem CID | 140876270 |
| Molecular Formula | C15H30BrNO3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [2-hydroxy-8-(2-methylprop-2-enoyloxy)octyl]-trimethylazanium bromide |
| SMILES | C=C(C)C(=O)OCCCCCCC(O)C[N+](C)(C)C.[Br-] |
| InChI | InChI=1S/C15H30NO3.BrH/c1-13(2)15(18)19-11-9-7-6-8-10-14(17)12-16(3,4)5;/h14,17H,1,6-12H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | ZRGODBRKVLCGQB-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|