C14H28NO6P — CID 25154168
[7-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)heptan-2-yl] hydrogen phosphate (PubChem CID 25154168) has the molecular formula C14H28NO6P and a molecular weight of 337.35 g/mol. Its IUPAC name is [7-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)heptan-2-yl] hydrogen phosphate.
| Compound Name | [7-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)heptan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 25154168 |
| Molecular Formula | C14H28NO6P |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [7-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)heptan-2-yl] hydrogen phosphate |
| SMILES | C=C(C)C(=O)OCCCCCC(C[N+](C)(C)C)OP(=O)([O-])O |
| InChI | InChI=1S/C14H28NO6P/c1-12(2)14(16)20-10-8-6-7-9-13(11-15(3,4)5)21-22(17,18)19/h13H,1,6-11H2,2-5H3,(H-,17,18,19) |
| InChIKey | ODAJAOHWQGTIMC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|