C13H26NO6P — CID 25154167
[6-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)hexan-2-yl] hydrogen phosphate (PubChem CID 25154167) has the molecular formula C13H26NO6P and a molecular weight of 323.33 g/mol. Its IUPAC name is [6-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)hexan-2-yl] hydrogen phosphate.
| Compound Name | [6-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)hexan-2-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 25154167 |
| Molecular Formula | C13H26NO6P |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [6-(2-methylprop-2-enoyloxy)-1-(trimethylazaniumyl)hexan-2-yl] hydrogen phosphate |
| SMILES | C=C(C)C(=O)OCCCCC(C[N+](C)(C)C)OP(=O)([O-])O |
| InChI | InChI=1S/C13H26NO6P/c1-11(2)13(15)19-9-7-6-8-12(10-14(3,4)5)20-21(16,17)18/h12H,1,6-10H2,2-5H3,(H-,16,17,18) |
| InChIKey | AXNLAFCFXKNXDK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|