C13H25O6P — CID 158195608
4-phosphonooxynonyl 2-methylprop-2-enoate (PubChem CID 158195608) has the molecular formula C13H25O6P and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-phosphonooxynonyl 2-methylprop-2-enoate.
| Compound Name | 4-phosphonooxynonyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158195608 |
| Molecular Formula | C13H25O6P |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-phosphonooxynonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCCCC)OP(=O)(O)O |
| InChI | InChI=1S/C13H25O6P/c1-4-5-6-8-12(19-20(15,16)17)9-7-10-18-13(14)11(2)3/h12H,2,4-10H2,1,3H3,(H2,15,16,17) |
| InChIKey | GAHNODSWHAIYRT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|