C20H41NO6P+ — CID 87326902
[7-(2-methylprop-2-enoyloxy)-4-phosphonooxyheptyl]-tripropylazanium (PubChem CID 87326902) has the molecular formula C20H41NO6P+ and a molecular weight of 422.52 g/mol. Its IUPAC name is [7-(2-methylprop-2-enoyloxy)-4-phosphonooxyheptyl]-tripropylazanium.
| Compound Name | [7-(2-methylprop-2-enoyloxy)-4-phosphonooxyheptyl]-tripropylazanium |
|---|---|
| PubChem CID | 87326902 |
| Molecular Formula | C20H41NO6P+ |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | [7-(2-methylprop-2-enoyloxy)-4-phosphonooxyheptyl]-tripropylazanium |
| SMILES | C=C(C)C(=O)OCCCC(CCC[N+](CCC)(CCC)CCC)OP(=O)(O)O |
| InChI | InChI=1S/C20H40NO6P/c1-6-13-21(14-7-2,15-8-3)16-9-11-19(27-28(23,24)25)12-10-17-26-20(22)18(4)5/h19H,4,6-17H2,1-3,5H3,(H-,23,24,25)/p+1 |
| InChIKey | XFWRAAUKJDCKEZ-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|