C20H43NO10P2 — CID 87327166
5-(2-methylprop-2-enoyloxy)pentyl 2-(tripropylazaniumyl)ethyl phosphate;phosphoric acid (PubChem CID 87327166) has the molecular formula C20H43NO10P2 and a molecular weight of 519.51 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoyloxy)pentyl 2-(tripropylazaniumyl)ethyl phosphate;phosphoric acid.
| Compound Name | 5-(2-methylprop-2-enoyloxy)pentyl 2-(tripropylazaniumyl)ethyl phosphate;phosphoric acid |
|---|---|
| PubChem CID | 87327166 |
| Molecular Formula | C20H43NO10P2 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 5-(2-methylprop-2-enoyloxy)pentyl 2-(tripropylazaniumyl)ethyl phosphate;phosphoric acid |
| SMILES | C=C(C)C(=O)OCCCCCOP(=O)([O-])OCC[N+](CCC)(CCC)CCC.O=P(O)(O)O |
| InChI | InChI=1S/C20H40NO6P.H3O4P/c1-6-12-21(13-7-2,14-8-3)15-18-27-28(23,24)26-17-11-9-10-16-25-20(22)19(4)5;1-5(2,3)4/h4,6-18H2,1-3,5H3;(H3,1,2,3,4) |
| InChIKey | OBCSJFWPSCHNHI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|