C16H26KO8P — CID 122611569
potassium bis[4-(2-methylprop-2-enoyloxy)butyl] phosphate (PubChem CID 122611569) has the molecular formula C16H26KO8P and a molecular weight of 416.45 g/mol. Its IUPAC name is potassium bis[4-(2-methylprop-2-enoyloxy)butyl] phosphate.
| Compound Name | potassium bis[4-(2-methylprop-2-enoyloxy)butyl] phosphate |
|---|---|
| PubChem CID | 122611569 |
| Molecular Formula | C16H26KO8P |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | potassium bis[4-(2-methylprop-2-enoyloxy)butyl] phosphate |
| SMILES | C=C(C)C(=O)OCCCCOP(=O)([O-])OCCCCOC(=O)C(=C)C.[K+] |
| InChI | InChI=1S/C16H27O8P.K/c1-13(2)15(17)21-9-5-7-11-23-25(19,20)24-12-8-6-10-22-16(18)14(3)4;/h1,3,5-12H2,2,4H3,(H,19,20);/q;+1/p-1 |
| InChIKey | GPMHFCHOIVUXDS-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|