C17H35NO6P+ — CID 87834394
triethyl-[4-[hydroxy-[3-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]oxybutyl]azanium (PubChem CID 87834394) has the molecular formula C17H35NO6P+ and a molecular weight of 380.44 g/mol. Its IUPAC name is triethyl-[4-[hydroxy-[3-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]oxybutyl]azanium.
| Compound Name | triethyl-[4-[hydroxy-[3-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]oxybutyl]azanium |
|---|---|
| PubChem CID | 87834394 |
| Molecular Formula | C17H35NO6P+ |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | triethyl-[4-[hydroxy-[3-(2-methylprop-2-enoyloxy)propoxy]phosphoryl]oxybutyl]azanium |
| SMILES | C=C(C)C(=O)OCCCOP(=O)(O)OCCCC[N+](CC)(CC)CC |
| InChI | InChI=1S/C17H34NO6P/c1-6-18(7-2,8-3)12-9-10-14-23-25(20,21)24-15-11-13-22-17(19)16(4)5/h4,6-15H2,1-3,5H3/p+1 |
| InChIKey | CCDMREWPSVOBOD-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|