C15H35NO7P+ — CID 174822784
butyl 2-methylprop-2-enoate;2-[ethoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium;hydrate (PubChem CID 174822784) has the molecular formula C15H35NO7P+ and a molecular weight of 372.42 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-[ethoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium;hydrate.
| Compound Name | butyl 2-methylprop-2-enoate;2-[ethoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium;hydrate |
|---|---|
| PubChem CID | 174822784 |
| Molecular Formula | C15H35NO7P+ |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-[ethoxy(hydroxy)phosphoryl]oxyethyl-trimethylazanium;hydrate |
| SMILES | C=C(C)C(=O)OCCCC.CCOP(=O)(O)OCC[N+](C)(C)C.O |
| InChI | InChI=1S/C8H14O2.C7H18NO4P.H2O/c1-4-5-6-10-8(9)7(2)3;1-5-11-13(9,10)12-7-6-8(2,3)4;/h2,4-6H2,1,3H3;5-7H2,1-4H3;1H2/p+1 |
| InChIKey | XUOCRCDHBBVSEO-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|