C17H32ClNO4 — CID 87942393
butyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride (PubChem CID 87942393) has the molecular formula C17H32ClNO4 and a molecular weight of 349.90 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride.
| Compound Name | butyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride |
|---|---|
| PubChem CID | 87942393 |
| Molecular Formula | C17H32ClNO4 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | butyl 2-methylprop-2-enoate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride |
| SMILES | C=C(C)C(=O)OCCCC.C=C(C)C(=O)OCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C9H18NO2.C8H14O2.ClH/c1-8(2)9(11)12-7-6-10(3,4)5;1-4-5-6-10-8(9)7(2)3;/h1,6-7H2,2-5H3;2,4-6H2,1,3H3;1H/q+1;;/p-1 |
| InChIKey | PRVHSCYYHRUULQ-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|