C13H25ClN2O3 — CID 6455489
2-methylprop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride (PubChem CID 6455489) has the molecular formula C13H25ClN2O3 and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-methylprop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride.
| Compound Name | 2-methylprop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride |
|---|---|
| PubChem CID | 6455489 |
| Molecular Formula | C13H25ClN2O3 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-methylprop-2-enamide;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)C.C=C(C)C(N)=O.[Cl-] |
| InChI | InChI=1S/C9H18NO2.C4H7NO.ClH/c1-8(2)9(11)12-7-6-10(3,4)5;1-3(2)4(5)6;/h1,6-7H2,2-5H3;1H2,2H3,(H2,5,6);1H/q+1;;/p-1 |
| InChIKey | JMZPTPHKRPTIFT-UHFFFAOYSA-M |
| XLogP | -2.14 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|