C16H29NO7S — CID 126739957
3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 126739957) has the molecular formula C16H29NO7S and a molecular weight of 379.48 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 126739957 |
| Molecular Formula | C16H29NO7S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)propane-1-sulfonate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCCCS(=O)(=O)[O-].C=C(C)C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C9H18NO2.C7H12O5S/c1-8(2)9(11)12-7-6-10(3,4)5;1-6(2)7(8)12-4-3-5-13(9,10)11/h1,6-7H2,2-5H3;1,3-5H2,2H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | FWZZJOHIMHYIHF-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|