C22H43N2O10S2+ — CID 157176780
2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethanesulfonate;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(4-sulfobutyl)azanium (PubChem CID 157176780) has the molecular formula C22H43N2O10S2+ and a molecular weight of 559.72 g/mol. Its IUPAC name is 2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethanesulfonate;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(4-sulfobutyl)azanium.
| Compound Name | 2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethanesulfonate;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 157176780 |
| Molecular Formula | C22H43N2O10S2+ |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 2-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]ethanesulfonate;dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(4-sulfobutyl)azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCCCS(=O)(=O)O.C=C(C)C(=O)OCC[N+](C)(C)CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H23NO5S.C10H19NO5S/c1-11(2)12(14)18-9-8-13(3,4)7-5-6-10-19(15,16)17;1-9(2)10(12)16-7-5-11(3,4)6-8-17(13,14)15/h1,5-10H2,2-4H3;1,5-8H2,2-4H3/p+1 |
| InChIKey | DVPMCLHBQGSFAH-UHFFFAOYSA-O |
| XLogP | 0.58 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|