C14H27N2O6S+ — CID 175218441
dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium;prop-2-enamide (PubChem CID 175218441) has the molecular formula C14H27N2O6S+ and a molecular weight of 351.45 g/mol. Its IUPAC name is dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium;prop-2-enamide.
| Compound Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium;prop-2-enamide |
|---|---|
| PubChem CID | 175218441 |
| Molecular Formula | C14H27N2O6S+ |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(3-sulfopropyl)azanium;prop-2-enamide |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)O.C=CC(N)=O |
| InChI | InChI=1S/C11H21NO5S.C3H5NO/c1-10(2)11(13)17-8-7-12(3,4)6-5-9-18(14,15)16;1-2-3(4)5/h1,5-9H2,2-4H3;2H,1H2,(H2,4,5)/p+1 |
| InChIKey | NKVOAHCZMOFMDC-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|