C9H21N2O5S+ — CID 162702755
dimethyl-[2-(methylcarbamoyloxy)ethyl]-(3-sulfopropyl)azanium (PubChem CID 162702755) has the molecular formula C9H21N2O5S+ and a molecular weight of 269.34 g/mol. Its IUPAC name is dimethyl-[2-(methylcarbamoyloxy)ethyl]-(3-sulfopropyl)azanium.
| Compound Name | dimethyl-[2-(methylcarbamoyloxy)ethyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 162702755 |
| Molecular Formula | C9H21N2O5S+ |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | dimethyl-[2-(methylcarbamoyloxy)ethyl]-(3-sulfopropyl)azanium |
| SMILES | CNC(=O)OCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C9H20N2O5S/c1-10-9(12)16-7-6-11(2,3)5-4-8-17(13,14)15/h4-8H2,1-3H3,(H-,10,12,13,14,15)/p+1 |
| InChIKey | PHXOFTAMSUWGTL-UHFFFAOYSA-O |
| XLogP | -0.30 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|