C9H21N2O4S+ — CID 122550419
(4-amino-4-oxobutyl)-dimethyl-(3-sulfopropyl)azanium (PubChem CID 122550419) has the molecular formula C9H21N2O4S+ and a molecular weight of 253.34 g/mol. Its IUPAC name is (4-amino-4-oxobutyl)-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | (4-amino-4-oxobutyl)-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 122550419 |
| Molecular Formula | C9H21N2O4S+ |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (4-amino-4-oxobutyl)-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCC(N)=O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C9H20N2O4S/c1-11(2,6-3-5-9(10)12)7-4-8-16(13,14)15/h3-8H2,1-2H3,(H2-,10,12,13,14,15)/p+1 |
| InChIKey | BPYFXXSYCWJJDP-UHFFFAOYSA-O |
| XLogP | -0.39 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|