C13H28NO5S+ — CID 59513010
2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 59513010) has the molecular formula C13H28NO5S+ and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 59513010 |
| Molecular Formula | C13H28NO5S+ |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | CCC(C)(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C13H27NO5S/c1-6-13(2,3)12(15)19-10-9-14(4,5)8-7-11-20(16,17)18/h6-11H2,1-5H3/p+1 |
| InChIKey | FWWZFQLWNLEREG-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|