C17H35NO9S2 — CID 91582166
2-(2,2-dimethylbutanoylamino)ethanesulfonic acid;3-(2,2-dimethylbutanoyloxy)propane-1-sulfonic acid (PubChem CID 91582166) has the molecular formula C17H35NO9S2 and a molecular weight of 461.60 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoylamino)ethanesulfonic acid;3-(2,2-dimethylbutanoyloxy)propane-1-sulfonic acid.
| Compound Name | 2-(2,2-dimethylbutanoylamino)ethanesulfonic acid;3-(2,2-dimethylbutanoyloxy)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 91582166 |
| Molecular Formula | C17H35NO9S2 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-(2,2-dimethylbutanoylamino)ethanesulfonic acid;3-(2,2-dimethylbutanoyloxy)propane-1-sulfonic acid |
| SMILES | CCC(C)(C)C(=O)NCCS(=O)(=O)O.CCC(C)(C)C(=O)OCCCS(=O)(=O)O |
| InChI | InChI=1S/C9H18O5S.C8H17NO4S/c1-4-9(2,3)8(10)14-6-5-7-15(11,12)13;1-4-8(2,3)7(10)9-5-6-14(11,12)13/h4-7H2,1-3H3,(H,11,12,13);4-6H2,1-3H3,(H,9,10)(H,11,12,13) |
| InChIKey | CAFKYSLHWBJLSY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|