C8H15O5S- — CID 59639215
2-(2,2-dimethylbutanoyloxy)ethanesulfonate (PubChem CID 59639215) has the molecular formula C8H15O5S- and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethanesulfonate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethanesulfonate |
|---|---|
| PubChem CID | 59639215 |
| Molecular Formula | C8H15O5S- |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethanesulfonate |
| SMILES | CCC(C)(C)C(=O)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H16O5S/c1-4-8(2,3)7(9)13-5-6-14(10,11)12/h4-6H2,1-3H3,(H,10,11,12)/p-1 |
| InChIKey | DADUPKZIBWONQZ-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|