C16H34N2O5S — CID 91272094
2-sulfamoylethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide (PubChem CID 91272094) has the molecular formula C16H34N2O5S and a molecular weight of 366.52 g/mol. Its IUPAC name is 2-sulfamoylethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide.
| Compound Name | 2-sulfamoylethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide |
|---|---|
| PubChem CID | 91272094 |
| Molecular Formula | C16H34N2O5S |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-sulfamoylethyl 2,2-dimethylbutanoate;N,N,2,2-tetramethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)C.CCC(C)(C)C(=O)OCCS(N)(=O)=O |
| InChI | InChI=1S/C8H17NO4S.C8H17NO/c1-4-8(2,3)7(10)13-5-6-14(9,11)12;1-6-8(2,3)7(10)9(4)5/h4-6H2,1-3H3,(H2,9,11,12);6H2,1-5H3 |
| InChIKey | LTIPVOCPBJFZHX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |