C11H25NO5S — CID 91442841
2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;methanesulfonate (PubChem CID 91442841) has the molecular formula C11H25NO5S and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;methanesulfonate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;methanesulfonate |
|---|---|
| PubChem CID | 91442841 |
| Molecular Formula | C11H25NO5S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;methanesulfonate |
| SMILES | CCC(C)(C)C(=O)OCC[NH+](C)C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H21NO2.CH4O3S/c1-6-10(2,3)9(12)13-8-7-11(4)5;1-5(2,3)4/h6-8H2,1-5H3;1H3,(H,2,3,4) |
| InChIKey | LGGVQXRSDPGJQA-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|