C28H57NO6 — CID 159475800
butyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;2-ethyl-2-methylpentanoate (PubChem CID 159475800) has the molecular formula C28H57NO6 and a molecular weight of 503.77 g/mol. Its IUPAC name is butyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;2-ethyl-2-methylpentanoate.
| Compound Name | butyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;2-ethyl-2-methylpentanoate |
|---|---|
| PubChem CID | 159475800 |
| Molecular Formula | C28H57NO6 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 503.42 |
| IUPAC Name | butyl 2,2-dimethylbutanoate;2-(2,2-dimethylbutanoyloxy)ethyl-dimethylazanium;2-ethyl-2-methylpentanoate |
| SMILES | CCC(C)(C)C(=O)OCC[NH+](C)C.CCCC(C)(CC)C(=O)[O-].CCCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C10H21NO2.C10H20O2.C8H16O2/c1-6-10(2,3)9(12)13-8-7-11(4)5;1-5-7-8-12-9(11)10(3,4)6-2;1-4-6-8(3,5-2)7(9)10/h6-8H2,1-5H3;5-8H2,1-4H3;4-6H2,1-3H3,(H,9,10) |
| InChIKey | LWJDGOBVMZMSJL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|